9-Borabicyclo[3.3.1]nonane
- Product Name9-Borabicyclo[3.3.1]nonane
- CAS280-64-8
- MFC8H15B
- MW122.02
- EINECS206-000-9
- MOL File280-64-8.mol
Chemical Properties
| Melting point | 140-142 °C |
| Boiling point | 68-70 °C |
| Density | 0.894 g/mL at 25 °C |
| Flash point | 1 °F |
| storage temp. | Flammables area |
| solubility | Miscible with ether, hexane, benzene, toluene, carbon tetrachloride, chloroform, dimethylsulfide and dichloromethane. Slightly miscible with cyclohexane, dimethoxyethane, diglyme and dioxane. |
| form | liquid |
| Water Solubility | reacts |
| Sensitive | Air & Moisture Sensitive |
| BRN | 605509 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | InChI=1S/C8H15B/c1-3-7-5-2-6-8(4-1)9-7/h7-9H,1-6H2 |
| InChIKey | FEJUGLKDZJDVFY-OCAPTIKFSA-N |
| SMILES | C12BC(CCC1)CCC2 |
| EPA Substance Registry System | 9-Borabicyclo[3.3.1]nonane (280-64-8) |
Safety Information
| Hazard Codes | F,Xn,Xi,N |
| Risk Statements | 14-20/21/22-36/37/38-36/37-19-14/15-11-67-65-62-51/53-48/20-38-40 |
| Safety Statements | 16-26-36/37/39-45-43-33-62-61-36/37-29-7/8-37/39 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 3 |
| F | 1-10-34 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 Water-react 1 |