Isoxepac
- Product NameIsoxepac
- CAS55453-87-7
- MFC16H12O4
- MW268.26
- EINECS611-268-9
- MOL File55453-87-7.mol
Chemical Properties
| Melting point | 130-132°C |
| Boiling point | 528.2±50.0 °C(Predicted) |
| Density | 1.39 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 4.24±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,5237 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H12O4/c17-15(18)8-10-5-6-14-13(7-10)16(19)12-4-2-1-3-11(12)9-20-14/h1-7H,8-9H2,(H,17,18) |
| InChIKey | QFGMXJOBTNZHEL-UHFFFAOYSA-N |
| SMILES | O1CC2=CC=CC=C2C(=O)C2=CC(CC(O)=O)=CC=C12 |
| CAS DataBase Reference | 55453-87-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-62 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| RTECS | HQ4110000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2932996560 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 2 STOT RE 1 |
| Toxicity | LD50 orally in rats: 199 mg/kg (Ueno) |