| Melting point |
71-72°C |
| Boiling point |
293.03°C (rough estimate) |
| Density |
1.1603 (rough estimate) |
| refractive index |
1.5620 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| pka |
1.40±0.10(Predicted) |
| color |
White to Orange to Green |
| Water Solubility |
Insoluble in water. |
| BRN |
2089466 |
| InChI |
InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChIKey |
DVVXXHVHGGWWPE-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC=C1N(C)C |
| CAS DataBase Reference |
610-16-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoic acid, 2-(dimethylamino)- (610-16-2) |
