N,N-DIMETHYL-4,4'-AZODIANILINE
- Product NameN,N-DIMETHYL-4,4'-AZODIANILINE
- CAS539-17-3
- MFC14H16N4
- MW240.3
- EINECS208-712-5
- MOL File539-17-3.mol
Chemical Properties
| Melting point | 190-195 °C (dec.) |
| Boiling point | 373.02°C (rough estimate) |
| Density | 1.0236 (rough estimate) |
| refractive index | 1.4850 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.43±0.10(Predicted) |
| form | powder to crystal |
| color | Yellow to Amber to Dark red |
| Water Solubility | 120.2ug/L(25 ºC) |
| BRN | 748253 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H16N4/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,15H2,1-2H3/b17-16+ |
| InChIKey | BVRIUXYMUSKBHG-WUKNDPDISA-N |
| SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(N)cc2 |
| CAS DataBase Reference | 539-17-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-[(4-aminophenyl)azo]-N,N-dimethyl- (539-17-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BX5020000 |
| F | 8-9-23 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
