FEMA 2952
- Product NameFEMA 2952
- CAS17369-59-4
- MFC11H10O2
- MW174.2
- EINECS241-402-8
- MOL File17369-59-4.mol
Chemical Properties
| Melting point | 5 °C(lit.) |
| Boiling point | 170 °C12 mm Hg(lit.) |
| Density | 1.122 g/mL at 25 °C(lit.) |
| refractive index | n |
| FEMA | 2952 | 3-PROPYLIDENEPHTHALIDE |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| Appearance | Light yellow to yellow Liquid |
| Odor | at 10.00 % in dipropylene glycol. celery herbal cortex lovage maple fenugreek phenolic brothy vegetable brown |
| Odor Type | herbal |
| biological source | synthetic |
| JECFA Number | 1168 |
| BRN | 4486 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | InChI=1S/C11H10O2/c1-2-5-10-8-6-3-4-7-9(8)11(12)13-10/h3-7H,2H2,1H3 |
| InChIKey | NGSZDVVHIGAMOJ-UHFFFAOYSA-N |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 23-24/25-37-24 |
| WGK Germany | 3 |
| RTECS | NP7235000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1B |
