| Melting point |
55-58 °C (lit.) |
| Boiling point |
143 °C / 30mmHg |
| Density |
0.99±0.1 g/cm3(Predicted) |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
Liquid |
| color |
White to Light yellow to Light orange |
| Stability |
Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C10H11N/c1-8-7-9-5-3-4-6-10(9)11(8)2/h3-7H,1-2H3 |
| InChIKey |
BJMUOUXGBFNLSN-UHFFFAOYSA-N |
| SMILES |
N1(C)C2=C(C=CC=C2)C=C1C |
| CAS DataBase Reference |
875-79-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
1H-indole, 1,2-dimethyl-(875-79-6) |
