| Melting point |
<25°C |
| Boiling point |
281 °C(lit.) |
| Density |
1.327 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.475(lit.) |
| Flash point |
167 °F |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| Specific Gravity |
1.327 |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
1768655 |
| InChI |
1S/C6H12Cl6Si2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2 |
| InChIKey |
ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| SMILES |
Cl[Si](Cl)(Cl)CCCCCC[Si](Cl)(Cl)Cl |
| EPA Substance Registry System |
Silane, 1,6-hexanediylbis[trichloro- (13083-94-8) |