Ethyl 5-chloro-2-indolecarboxylate
- Product NameEthyl 5-chloro-2-indolecarboxylate
- CAS4792-67-0
- MFC11H10ClNO2
- MW223.66
- EINECS225-345-6
- MOL File4792-67-0.mol
Chemical Properties
| Melting point | 166-168 °C (lit.) |
| Boiling point | 375.0±22.0 °C(Predicted) |
| Density | 1.2405 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.10±0.30(Predicted) |
| form | Powder or Crystals |
| color | Yellow to orange to tan or light brown |
| BRN | 170255 |
| InChI | InChI=1S/C11H10ClNO2/c1-2-15-11(14)10-6-7-5-8(12)3-4-9(7)13-10/h3-6,13H,2H2,1H3 |
| InChIKey | LWKIFKYHCJAIAB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C=C1C(OCC)=O |
| CAS DataBase Reference | 4792-67-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |