| Melting point |
172-180 °C |
| Boiling point |
250.62°C (rough estimate) |
| Density |
1.47 |
| refractive index |
-16.5 ° (C=1.5, MeOH) |
| storage temp. |
Inert atmosphere,2-8°C |
| solubility |
Methanol (Slightly), Water (Slightly) |
| form |
Crystalline Powder |
| pka |
12.92±0.70(Predicted) |
| color |
White |
| Water Solubility |
Soluble in water and methanol. |
| BRN |
81569 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7-/s3 |
| InChIKey |
HOVAGTYPODGVJG-CHUHMKGRNA-N |
| SMILES |
C([C@@H]1[C@@H]([C@H](O)[C@@H](O)[C@H](OC)O1)O)O |&1:1,2,3,5,7,r| |
| CAS DataBase Reference |
1824-94-8(CAS DataBase Reference) |
