4-Chloro-3-nitrobenzoyl chloride
- Product Name4-Chloro-3-nitrobenzoyl chloride
- CAS38818-50-7
- MFC7H3Cl2NO3
- MW220.01
- EINECS254-133-6
- MOL File38818-50-7.mol
Chemical Properties
| Melting point | 47-54 °C(lit.) |
| Boiling point | 301.7±22.0 °C(Predicted) |
| Density | 1.5741 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| Flash point | 230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly) |
| form | powder |
| color | White |
| Stability | Stable, but may be air and moisture sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H3Cl2NO3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H |
| InChIKey | IWLGXPWQZDOMSB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(ccc1Cl)C(Cl)=O |
| CAS DataBase Reference | 38818-50-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-3-nitrobenzoyl chloride(38818-50-7) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-21 |
| Safety Statements | 26-27-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
