| Melting point |
87-89 °C(lit.) |
| Boiling point |
281.58°C (estimate) |
| Density |
0.9389 (estimate) |
| refractive index |
1.5073 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
10.21±0.10(Predicted) |
| color |
Pale Brown to Light Brown |
| Stability |
Stable. Incompatible with bases, acid chlorides, acid anhydrides, oxidizing agents, brass, steel, copper, copper alloys. |
| InChI |
InChI=1S/C14H22O/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9,15H,1-6H3 |
| InChIKey |
ZDWSNKPLZUXBPE-UHFFFAOYSA-N |
| SMILES |
C1(O)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| LogP |
4.640 |
| CAS DataBase Reference |
1138-52-9(CAS DataBase Reference) |
| EPA Substance Registry System |
3,5-Di-tert-butylphenol (1138-52-9) |
