| Melting point |
189-192 °C(lit.) |
| Density |
1.494±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
H2O: 0.1 M at 20 °C, clear, colorless |
| form |
powder to crystal |
| color |
White to Almost white |
| PH Range |
7.0 - 8.2 |
| PH |
4.0-5.5 (20℃, 0.1M in H2O) |
| pka |
7.6(at 25℃) |
| Water Solubility |
almost transparency |
| BRN |
2105454 |
| Major Application |
diagnostic assay manufacturing |
| InChI |
InChI=1S/C7H17NO6S/c9-3-1-8(2-4-10)5-7(11)6-15(12,13)14/h7,9-11H,1-6H2,(H,12,13,14) |
| InChIKey |
XCBLFURAFHFFJF-UHFFFAOYSA-N |
| SMILES |
C(S(O)(=O)=O)C(O)CN(CCO)CCO |
| CAS DataBase Reference |
68399-80-4(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Propanesulfonic acid, 3-[bis(2-hydroxyethyl)amino]-2-hydroxy- (68399-80-4) |
| Absorption |
≤0.025 at 260 in H2O at 0.1M ≤0.025 at 280 in H2O at 0.1M |