N-Chlorophthalimide
- Product NameN-Chlorophthalimide
- CAS3481-09-2
- MFC8H4ClNO2
- MW181.58
- EINECS222-459-8
- MOL File3481-09-2.mol
Chemical Properties
| Melting point | 188-198 °C (lit.) |
| Boiling point | 315.1±25.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -3.53±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H4ClNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
| InChIKey | WDRFYIPWHMGQPN-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1Cl |
| CAS DataBase Reference | 3481-09-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 1 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |