1,2,3,4-Cyclobutanetetracarboxylic Dianhydride
- Product Name1,2,3,4-Cyclobutanetetracarboxylic Dianhydride
- CAS4415-87-6
- MFC8H4O6
- MW196.11
- EINECS224-577-5
- MOL File4415-87-6.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 545.3±50.0 °C(Predicted) |
| Density | 1.823±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1430553 |
| InChI | InChI=1S/C8H4O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4H |
| InChIKey | YGYCECQIOXZODZ-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C(C2C1=O)C(=O)OC3=O |
| CAS DataBase Reference | 4415-87-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
