| Melting point |
123-125 °C(lit.) |
| Boiling point |
293.08°C (rough estimate) |
| Density |
1.2166 (rough estimate) |
| refractive index |
1.5430 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
4.03±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Yellow to Green |
| InChI |
InChI=1S/C10H12O4/c1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| InChIKey |
BBZDYQUXRFATHZ-UHFFFAOYSA-N |
| SMILES |
C1(CC(O)=O)=CC(OC)=CC=C1OC |
| CAS DataBase Reference |
1758-25-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Acetic acid, 2,5-dimethoxyphenyl-(1758-25-4) |
| EPA Substance Registry System |
Benzeneacetic acid, 2,5-dimethoxy- (1758-25-4) |
