| Melting point |
90-94 °C |
| Boiling point |
312.97°C (rough estimate) |
| Density |
1.42 |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Store below +30°C. |
| form |
powder to crystal |
| pka |
13.83±0.70(Predicted) |
| color |
Light yellow to Yellow to Orange |
| Water Solubility |
2.2g/L(room temperature) |
| Merck |
14,6580 |
| BRN |
1959178 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
1S/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
| InChIKey |
BUNFNRVLMKHKIT-UHFFFAOYSA-N |
| SMILES |
[N+](=O)([O-])c1c(cccc1)NC(=O)C |
| CAS DataBase Reference |
552-32-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Acetamide, N-(2-nitrophenyl)- (552-32-9) |
