3-Amino-2-methylphenol
- Product Name3-Amino-2-methylphenol
- CAS53222-92-7
- MFC7H9NO
- MW123.15
- EINECS258-438-5
- MOL File53222-92-7.mol
Chemical Properties
| Melting point | 129-130 °C(lit.) |
| Boiling point | 229.26°C (rough estimate) |
| Density | 1.0877 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 10.36±0.10(Predicted) |
| form | Solid |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H9NO/c1-5-6(8)3-2-4-7(5)9/h2-4,9H,8H2,1H3 |
| InChIKey | FLROJJGKUKLCAE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(N)=C1C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |