3-chloro-2-methoxybenzoic acid
- Product Name3-chloro-2-methoxybenzoic acid
- CAS3260-93-3
- MFC8H7ClO3
- MW186.59
- EINECS
- MOL File3260-93-3.mol
Chemical Properties
| Melting point | 118-123 °C |
| Boiling point | 306.4±22.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.72±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C8H7ClO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3,(H,10,11) |
| InChIKey | NKVUYEGKHRDEBB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1OC |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2916399090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
