5-Amino-2-methoxyphenol
- Product Name5-Amino-2-methoxyphenol
- CAS1687-53-2
- MFC7H9NO2
- MW139.15
- EINECS216-873-8
- MOL File1687-53-2.mol
Chemical Properties
| Melting point | 130-132 °C(lit.) |
| Boiling point | 255.1°C (rough estimate) |
| Density | 1.1997 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | slightly soluble |
| pka | 10.02±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Water Solubility | slightly soluble |
| BRN | 2717084 |
| InChI | InChI=1S/C7H9NO2/c1-10-7-3-2-5(8)4-6(7)9/h2-4,9H,8H2,1H3 |
| InChIKey | BLQFHJKRTDIZLX-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(N)=CC=C1OC |
| CAS DataBase Reference | 1687-53-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Amino-2-methoxyphenol(1687-53-2) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-20/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| PackingGroup | II |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
