| Melting point |
<0°C |
| Boiling point |
130 °C |
| Density |
0.907±0.06 g/cm3(Predicted) |
| vapor pressure |
10Pa at 25℃ |
| refractive index |
1.4200 to 1.4240 |
| Flash point |
>100°C |
| storage temp. |
2-8°C, stored under nitrogen |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Water Solubility |
10ng/L at 20℃ |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| InChI |
InChI=1S/C16H36O4Si5/c1-13-21(5,6)17-25(18-22(7,8)14-2,19-23(9,10)15-3)20-24(11,12)16-4/h13-16H,1-4H2,5-12H3 |
| InChIKey |
JMTMWSZLPHDWBQ-UHFFFAOYSA-N |
| SMILES |
[Si](C=C)(C)(C)O[Si](O[Si](C=C)(C)C)(O[Si](C=C)(C)C)O[Si](C=C)(C)C |
| LogP |
9 at 20℃ |
| EPA Substance Registry System |
Trisiloxane, 1,5-diethenyl-3,3-bis[(ethenyldimethylsilyl)oxy]-1,1,5,5-tetramethyl- (60111-54-8) |
