
| CAS: | 2836-82-0 |
| MF: | C9H9FO |
| MW: | 152.17 |
| EINECS: | 220-627-5 |
| Product Categories: | C9;Carbonyl Compounds;Aromatic Ketones (substituted);Ketones;2836-82-0 |
| Mol File: | 2836-82-0.mol |
 |
|
| 2-Fluorophenylacetone Chemical Properties |
| Boiling point | 47 °C/0.05 mmHg (lit.) |
| density | 1.077 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.4989(lit.) |
| Fp | 185 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methyl Acetate: 50 mg/ml |
| form | Liquid |
| color | Pale yellow |
| InChI | InChI=1S/C9H9FO/c1-7(11)6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3 |
| InChIKey | BANVZEUCJHUPOI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1F)C(=O)C |
| CAS DataBase Reference | 2836-82-0(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.