
|
| 4-Amino-3,5-dichloro-alpha-bromoacetophenone Chemical Properties |
| Melting point | 142-1450C |
| Boiling point | 396.4±42.0 °C(Predicted) |
| density | 1.764±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| pka | -2.21±0.10(Predicted) |
| form | Solid |
| color | Off-White to Yellow |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H6BrCl2NO/c9-3-7(13)4-1-5(10)8(12)6(11)2-4/h1-2H,3,12H2 |
| InChIKey | ATKJJUFAWYSFID-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=C(N)C(Cl)=C1)CBr |
| CAS DataBase Reference | 37148-47-3 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.