
| CAS: | 571-44-8 |
| MF: | C19H28O2 |
| MW: | 288.43 |
| EINECS: | 200-533-0 |
| Product Categories: |
|
| Mol File: | 571-44-8.mol |
 |
|
| 4-Androsten-3b-ol-17-one Chemical Properties |
| Melting point | 135-137 °C |
| Boiling point | 428.5±45.0 °C(Predicted) |
| density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 14.39±0.60(Predicted) |
| color | White to Off-White |
| InChI | InChI=1/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-16,20H,3-10H2,1-2H3/t13-,14-,15-,16-,18-,19-/s3 |
| InChIKey | VMYTXBKVYDESSJ-XEZBUBAUNA-N |
| SMILES | C[C@]12CC[C@H](O)C=C1CC[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)CC[C@]21[H] |&1:1,4,10,12,18,22,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.