
| CAS: | 5586-88-9 |
| MF: | C9H9ClO |
| MW: | 168.62 |
| EINECS: | 226-986-4 |
| Product Categories: | Aromatic Ketones (substituted) |
| Mol File: | 5586-88-9.mol |
 |
|
| 4-Chlorophenylacetone Chemical Properties |
| Melting point | 6-8 °C |
| Boiling point | 132 °C |
| density | 1.151 |
| refractive index | 1.5325-1.5345 |
| Fp | >110℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear light yellow |
| CAS DataBase Reference | 5586-88-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanone,p-chlorophenyl-(5586-88-9) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.