
| CAS: | 456-03-1 |
| MF: | C9H9FO |
| MW: | 152.17 |
| EINECS: | 207-255-9 |
| Product Categories: | C9;Carbonyl Compounds;Aromatic Ketones (substituted);ketone;Fluorine Compounds;Ketones;Acetophenone Series;Fluorobenzene;Adehydes, Acetals & Ketones;456-03-1 |
| Mol File: | 456-03-1.mol |
 |
|
| 4'-Fluoropropiophenone Chemical Properties |
| Boiling point | 100-102 °C (22 mmHg) |
| density | 1.096 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.5059(lit.) |
| Fp | 170 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.096 |
| BRN | 1210310 |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(=O)CC |
| CAS DataBase Reference | 456-03-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-fluorophenyl)-(456-03-1) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.