
| CAS: | 138112-76-2 |
| MF: | C15H17NO2 |
| MW: | 243.3 |
| EINECS: | 629-727-7 |
| Product Categories: | APIS;Aromatics Compounds;Aromatics;Neurochemicals;API;Agomelatine;Valdoxan, Melitor, Thymanax;138112-76-2 |
| Mol File: | 138112-76-2.mol |
 |
|
| AGOMELATINE Chemical Properties |
| Melting point | 107-109°C |
| Boiling point | 478.8±28.0 °C(Predicted) |
| density | 1.109±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: >50mg/mL |
| form | powder |
| pka | 16.17±0.46(Predicted) |
| color | white to off-white |
| Merck | 14,190 |
| InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | YJYPHIXNFHFHND-UHFFFAOYSA-N |
| SMILES | C(NCCC1=C2C(C=CC(OC)=C2)=CC=C1)(=O)C |
| CAS DataBase Reference | 138112-76-2(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.