
| CAS: | 401900-40-1 |
| MF: | C19H18F3N3O6 |
| MW: | 441.36 |
| EINECS: | 803-892-7 |
| Product Categories: | Inhibitors;SARMS;Amines;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;APIs;Pharmaceuticals;401900-40-1 |
| Mol File: | 401900-40-1.mol |
 |
|
| Andarine Chemical Properties |
| Melting point | 70-74℃ |
| Boiling point | 698.7±55.0 °C(Predicted) |
| density | 1.47 |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.13±0.29(Predicted) |
| color | Light Yellow |
| Water Solubility | 1.2 mg/mL in water |
| BRN | 9666695 |
| InChIKey | YVXVTLGIDOACBJ-SFHVURJKSA-N |
| SMILES | C(NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1)(=O)[C@](O)(C)COC1=CC=C(NC(C)=O)C=C1 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.