
| CAS: | 913611-97-9 |
| MF: | C25H27N3O2S |
| MW: | 433.57 |
| EINECS: | 811-628-7 |
| Product Categories: | Dopamine D2 receptor partial agonist;API;Inhibitors;913611-97-9 |
| Mol File: | 913611-97-9.mol |
 |
|
| Brexpiprazole Chemical Properties |
| Melting point | 179 - 181oC |
| Boiling point | 675.2±55.0 °C(Predicted) |
| density | 1.245±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Dichloromethane (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.22±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C25H27N3O2S/c29-25-9-7-19-6-8-20(18-22(19)26-25)30-16-2-1-11-27-12-14-28(15-13-27)23-4-3-5-24-21(23)10-17-31-24/h3-10,17-18H,1-2,11-16H2,(H,26,29) |
| InChIKey | ZKIAIYBUSXZPLP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(OCCCCN3CCN(C4=C5C=CSC5=CC=C4)CC3)=C2)C=CC1=O |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.