
|
| Copper Peptide Chemical Properties |
| Melting point | >144°C (dec.) |
| Boiling point | 831.0±65.0 °C(Predicted) |
| density | 1.324 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Acid (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 3.11±0.10(Predicted) |
| color | Off-White |
| Stability: | Hygroscopic |
| InChIKey | MVORZMQFXBLMHM-QWRGUYRKSA-N |
| SMILES | C(O)(=O)[C@H](CCCCN)NC(=O)[C@H](CC1N=CNC=1)NC(=O)CN |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.