
| CAS: | 4579-64-0 |
| MF: | C17H18N2O2 |
| MW: | 282.34 |
| EINECS: | 224-964-9 |
| Product Categories: |
|
| Mol File: | 4579-64-0.mol |
 |
|
| D-Lysergic Acid Methyl Ester Chemical Properties |
| Melting point | 164-166 °C(Solv: benzene (71-43-2)) |
| Boiling point | 469.0±45.0 °C(Predicted) |
| density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 17.25±0.40(Predicted) |
| color | Pale Grey to Black |
| InChI | InChI=1/C17H18N2O2/c1-19-9-11(17(20)21-2)6-13-12-4-3-5-14-16(12)10(8-18-14)7-15(13)19/h3-6,8,11,15,18H,7,9H2,1-2H3/t11?,15-/s3 |
| InChIKey | RNHDWLRHUJZABX-RXHCFGRJNA-N |
| SMILES | C12C3C=CC=C4NC=C(C[C@@]1([H])N(C)CC(C(OC)=O)C=2)C=34 |&1:10,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.