
| CAS: | 152-62-5 |
| MF: | C21H28O2 |
| MW: | 312.45 |
| EINECS: | 205-806-8 |
| Product Categories: | INDOKLON;Pharma material;Intermediates & Fine Chemicals;Pharmaceuticals;Steroids;Steroid and Hormone;152-62-5 |
| Mol File: | 152-62-5.mol |
 |
|
| Dydrogesterone Chemical Properties |
| Melting point | 168-173°C |
| alpha | D25 -484.5° (chloroform) |
| Boiling point | 392.36°C (rough estimate) |
| density | 1.0697 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent). |
| color | White to Light Yellow |
| InChI | InChI=1/C21H28O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12,16-19H,6-11H2,1-3H3/t16-,17+,18-,19+,20+,21+/s3 |
| InChIKey | JGMOKGBVKVMRFX-HQZYFCCVSA-N |
| SMILES | C[C@@]12CCC(=O)C=C1C=C[C@@]1([H])[C@]3([H])CC[C@H](C(=O)C)[C@@]3(C)CC[C@@]21[H] |&1:1,10,12,16,20,24,r| |
| CAS DataBase Reference | 152-62-5(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.