
| CAS: | 5571-36-8 |
| MF: | C20H26O3 |
| MW: | 314.43 |
| EINECS: | 427-230-8 |
| Product Categories: | Intermediates;Intermediates & Fine Chemicals;Various Intermediates;Pharmaceuticals;Other APIs;5571-36-8 |
| Mol File: | 5571-36-8.mol |
 |
|
| Estradiene dione-3-keta Chemical Properties |
| Melting point | 152-154°C |
| Boiling point | 488.1±45.0 °C(Predicted) |
| density | 1.20±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly, Heated, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | White to Light Yellow |
| Water Solubility | 903μg/L at 25℃ |
| InChI | InChI=1/C20H26O3/c1-19-8-6-15-14-7-9-20(22-10-11-23-20)12-13(14)2-3-16(15)17(19)4-5-18(19)21/h6,16-17H,2-5,7-12H2,1H3/t16-,17+,19+/s3 |
| InChIKey | XUOQKQRMICQUQC-GDJQEYATNA-N |
| SMILES | C[C@@]12C(CC[C@@]1([H])[C@]1([H])CCC3CC4(OCCO4)CCC=3C1=CC2)=O |&1:1,5,7,r| |
| LogP | 4.74 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.