
| CAS: | 14769-73-4 |
| MF: | C11H12N2S |
| MW: | 204.29 |
| EINECS: | 238-836-5 |
| Product Categories: | 14769-73-4 |
| Mol File: | 14769-73-4.mol |
 |
|
| Levamisole Chemical Properties |
| Melting point | 60-61.5° |
| alpha | D25 -85.1° (c = 10 in chloroform) |
| Boiling point | 344.4±45.0 °C(Predicted) |
| density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.00±0.40(Predicted) |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | HLFSDGLLUJUHTE-SNVBAGLBSA-N |
| SMILES | S1CCN2C[C@H](C3=CC=CC=C3)N=C12 |
| CAS DataBase Reference | 14769-73-4(CAS DataBase Reference) |
| EPA Substance Registry System | Levamisole (14769-73-4) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.