| CAS: | 59-46-1 |
| MF: | C13H20N2O2 |
| MW: | 236.31 |
| EINECS: | 200-426-9 |
| Product Categories: | API;59-46-1 |
| Mol File: | 59-46-1.mol |
 |
|
| Procaine Chemical Properties |
| Melting point | 61° |
| Boiling point | 378.78°C (rough estimate) |
| density | 1.0604 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pKa 9.04±0.01(H2O,t=25,I=0.1(NaCl))(Approximate) |
| color | White to Off-White |
| Water Solubility | 9.45g/L(30 ºC) |
| Merck | 14,7757 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 |
| InChIKey | MFDFERRIHVXMIY-UHFFFAOYSA-N |
| SMILES | C(OCCN(CC)CC)(=O)C1=CC=C(N)C=C1 |
| CAS DataBase Reference | 59-46-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-amino-, 2-(diethylamino)ethyl ester(59-46-1) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
