
| CAS: | 154992-24-2 |
| MF: | C17H18F3N3O3 |
| MW: | 369.34 |
| EINECS: | 1592732-453-0 |
| Product Categories: | Inhibitors;154992-24-2 |
| Mol File: | 154992-24-2.mol |
 |
|
| RU 58841 Chemical Properties |
| Boiling point | 493.6±55.0 °C(Predicted) |
| density | 1.39 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMF: 33 mg/ml; DMSO: 25 mg/ml; Ethanol: 33 mg/ml; Ethanol:PBS(pH 7.2) (1:5): 0.16 mg/ml |
| form | Powder |
| pka | 15.09±0.10(Predicted) |
| InChI | InChI=1S/C17H18F3N3O3/c1-16(2)14(25)23(15(26)22(16)7-3-4-8-24)12-6-5-11(10-21)13(9-12)17(18,19)20/h5-6,9,24H,3-4,7-8H2,1-2H3 |
| InChIKey | ARBYGDBJECGMGA-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N2C(=O)N(CCCCO)C(C)(C)C2=O)C=C1C(F)(F)F |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.