
| CAS: | 1010396-29-8 |
| MF: | C18H13ClF4N2O3 |
| MW: | 416.75 |
| EINECS: | 1532714-185-1 |
| Product Categories: | 1010396-29-8 |
| Mol File: | 1010396-29-8.mol |
 |
| Melting point | 119-121 °C |
| Boiling point | 577.1±50.0 °C(Predicted) |
| density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.04±0.29(Predicted) |
| color | White to Off-White |
| optical activity | [α]/D 20±3°, c = 0.1 in chloroform |
| BRN | 19161994 |
| InChI | InChI=1S/C18H13ClF4N2O3/c1-17(27,9-28-12-4-5-14(19)15(20)7-12)16(26)25-11-3-2-10(8-24)13(6-11)18(21,22)23/h2-7,27H,9H2,1H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | SSFVOEAXHZGTRJ-KRWDZBQOSA-N |
| SMILES | C(NC1=CC=C(C#N)C(C(F)(F)F)=C1)(=O)[C@](O)(C)COC1=CC=C(Cl)C(F)=C1 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.