
| CAS: | 94-24-6 |
| MF: | C15H24N2O2 |
| MW: | 264.36 |
| EINECS: | 202-316-6 |
| Product Categories: | Pharmaceutical Intermediates;medical intermediate;API;94-24-6 |
| Mol File: | 94-24-6.mol |
 |
|
| Tetracaine Chemical Properties |
| Melting point | 41.0 to 45.0 °C |
| Boiling point | 407.59°C (rough estimate) |
| density | 1.0200 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | pKa 8.33±0.03(H2O t = 20.0 I = 0.10 (KCl)) (Uncertain) |
| color | White to Almost white |
| Water Solubility | 156mg/L(temperature not stated) |
| InChI | InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 |
| InChIKey | GKCBAIGFKIBETG-UHFFFAOYSA-N |
| SMILES | C(OCCN(C)C)(=O)C1=CC=C(NCCCC)C=C1 |
| LogP | 3.510 |
| CAS DataBase Reference | 94-24-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetracaine(94-24-6) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.