
| CAS: | 74163-84-1 |
| MF: | C16H21NO2 |
| MW: | 259.34 |
| EINECS: | 200-001-8 |
| Product Categories: |
|
| Mol File: | 74163-84-1.mol |
 |
|
| Troparil Chemical Properties |
| Boiling point | 350.2±42.0 °C(Predicted) |
| density | 1.099±0.06 g/cm3(Predicted) |
| pka | 9.95±0.60(Predicted) |
| InChI | InChI=1/C16H21NO2/c1-17-12-8-9-14(17)15(16(18)19-2)13(10-12)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-,13+,14+,15-/s3 |
| InChIKey | OMBOXYLBBHNWHL-YRABYYAXNA-N |
| SMILES | [C@@]12([H])N(C)[C@@]([H])(CC1)C[C@H](C1=CC=CC=C1)[C@@H]2C(OC)=O |&1:0,4,9,16,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.