| Melting point |
247 °C (subl.) (lit.) |
| Boiling point |
214.73°C (rough estimate) |
| Density |
0.8544 (rough estimate) |
| refractive index |
1.4880 (estimate) |
| Flash point |
240°C |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| pka |
15.38±0.20(Predicted) |
| form |
Crystalline Powder or Needles |
| color |
White to off-white |
| Water Solubility |
Soluble in ethanol , methanol, and diethyl ether. Partly miscible in water. |
| Sublimation |
240 ºC |
| BRN |
1903952 |
| Henry's Law Constant |
6.0×100 mol/(m3Pa) at 25℃, Roon et al. (2005) |
| InChI |
1S/C10H16O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2/t7-,8+,9-,10- |
| InChIKey |
VLLNJDMHDJRNFK-UHFFFAOYSA-N |
| SMILES |
OC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference |
768-95-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-Adamantanol(768-95-6) |