| Melting point |
212-214°C |
| Boiling point |
368.7°C (rough estimate) |
| Density |
1.162 |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6110 (estimate) |
| Flash point |
11 °C |
| storage temp. |
APPROX 4°C |
| solubility |
Chloroform (Heated), DMSO (Slightly), Methanol (Slightly) |
| pka |
2.28±0.10(Predicted) |
| Water Solubility |
8.6mg/L(22 ºC) |
| Merck |
13,7904 |
| BRN |
747081 |
| Henry's Law Constant |
2.1×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application |
agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI |
1S/C9H16ClN5/c1-5(2)11-8-13-7(10)14-9(15-8)12-6(3)4/h5-6H,1-4H3,(H2,11,12,13,14,15) |
| InChIKey |
WJNRPILHGGKWCK-UHFFFAOYSA-N |
| SMILES |
CC(C)Nc1nc(Cl)nc(NC(C)C)n1 |
| LogP |
3.01 at 25℃ and pH7.1 |
| CAS DataBase Reference |
139-40-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N'-bis(1-methylethyl)-(139-40-2) |
| EPA Substance Registry System |
Propazine (139-40-2) |