| Melting point |
56-61 °C(lit.) |
| Boiling point |
300°C |
| Density |
1.2833 |
| vapor pressure |
3.5(x 10-4 mmHg) at 20 °C (quoted, Howard, 1989)5.67(x 10-4 mmHg) at 25 °C (Banerjee et al., 1990) |
| refractive index |
1.4790 |
| Flash point |
207°C |
| storage temp. |
2-8°C |
| solubility |
Soluble in ethanol (Weast, 1986) and many other organic solvents including chloroform and
carbon tetrachloride. |
| form |
crystals |
| Water Solubility |
0.0182 g/100 mL |
| BRN |
2052046 |
| Henry's Law Constant |
4.8×100 mol/(m3Pa) at 25℃, Brockbank (2013) |
| Stability |
Stable, but shock sensitive. Incompatible with oxidizing agents, reducing agents, strong bases. Heating may cause explosion. |
| InChI |
1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3 |
| InChIKey |
XTRDKALNCIHHNI-UHFFFAOYSA-N |
| SMILES |
CC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O |
| CAS DataBase Reference |
606-20-2(CAS DataBase Reference) |
| IARC |
2B (Vol. 65) 1996 |
| NIST Chemistry Reference |
Benzene, 2-methyl-1,3-dinitro-(606-20-2) |
| EPA Substance Registry System |
2,6-Dinitrotoluene (606-20-2) |