| Melting point |
242-248 °C |
| alpha |
15.5 º (c=4, 15N formic acid) |
| Boiling point |
436.08°C (rough estimate) |
| Density |
1.2051 (rough estimate) |
| refractive index |
14.5 ° (C=4, 15mol/L Formic Acid) |
| storage temp. |
2-8°C |
| solubility |
Sparingly soluble or slightly soluble in water and in ethanol (96 per cent), practically insoluble in hexane and in methylene chloride. |
| form |
Powder |
| pka |
pKa 3.19±0.01 (H2O t=25.0 I=0.100(NaCl))(Approximate);7.87±0.02(H2O t=25.0 I=0.100(NaCl))(Approximate) |
| color |
White |
| Odor |
odorless with a sweet taste |
| PH |
pH(8g/l, 25℃) : 4.5~6.0 |
| biological source |
mouse |
| Water Solubility |
Soluble in formic acid, dimethyl sulfoxide. Sparingly soluble in water and ethanol. |
| Merck |
14,839 |
| BRN |
2223850 |
| Henry's Law Constant |
3.9×1012 mol/(m3Pa) at 25℃, HSDB (2015) |
| Sequence |
H-Asp-Phe-OMe |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
FLAVOURING |
| InChI |
1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
| InChIKey |
IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| SMILES |
COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(O)=O |
| LogP |
0.542 (est) |
| CAS DataBase Reference |
22839-47-0(CAS DataBase Reference) |
| EPA Substance Registry System |
L-Phenylalanine, L-.alpha.-aspartyl-, 2-methyl ester (22839-47-0) |