| Melting point |
-55 °C |
| Boiling point |
342 °C |
| Density |
1.025 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.490 |
| Flash point |
>110°C |
| storage temp. |
room temp |
| solubility |
Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form |
Liquid |
| color |
Clear colorless to slightly yellow |
| Odor |
Mild, pleasant. |
| Water Solubility |
Not miscible or difficult to mix in water. |
| BRN |
1987323 |
| Henry's Law Constant |
1.1×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application |
environmental |
| InChI |
1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey |
IPKKHRVROFYTEK-UHFFFAOYSA-N |
| SMILES |
CCCCCOC(=O)c1ccccc1C(=O)OCCCCC |
| CAS DataBase Reference |
131-18-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Dipentyl phthalate (131-18-0) |