| Melting point |
254-256°C (dec.) |
| Boiling point |
366.66°C (rough estimate) |
| Density |
1.5406 (rough estimate) |
| refractive index |
1.7180 (estimate) |
| Flash point |
2 °C |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
formic acid: soluble50mg/mL |
| form |
powder |
| pka |
-1.98±0.20(Predicted) |
| color |
yellow |
| biological source |
synthetic |
| Sensitive |
Light Sensitive |
| λmax |
365nm(DMSO)(lit.) |
| Merck |
14,4300 |
| BRN |
8317414 |
| Henry's Law Constant |
3.0×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application |
cleaning products clinical cosmetics food and beverages forensics and toxicology personal care pharmaceutical (small molecule) |
| InChI |
1S/C8H7N3O5/c12-8-10(3-4-15-8)9-5-6-1-2-7(16-6)11(13)14/h1-2,5H,3-4H2/b9-5+ |
| InChIKey |
PLHJDBGFXBMTGZ-UITAMQMPSA-N |
| SMILES |
[O-][N+](=O)c1ccc(\C=N\N2CCOC2=O)o1 |
| IARC |
3 (Vol. 31, Sup 7) 1987 |
| NIST Chemistry Reference |
Furazolidone(67-45-8) |
| EPA Substance Registry System |
Furazolidone (67-45-8) |