| Melting point |
196-198 °C(lit.) |
| Boiling point |
331.89°C (rough estimate) |
| Density |
1.1985 (rough estimate) |
| refractive index |
78 ° (C=5, 1mol/L HCl) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
almost transparency in 1mol/L HCl |
| form |
powder to crystal |
| pka |
9.96±0.15(Predicted) |
| color |
White to Orange to Green |
| optical activity |
[α]20/D +76°, c = 4.2 in 1 M HCl |
| BRN |
2808635 |
| Major Application |
peptide synthesis |
| InChI |
1S/C9H13N3O2/c10-8(9(14)12-11)5-6-1-3-7(13)4-2-6/h1-4,8,13H,5,10-11H2,(H,12,14)/t8-/m0/s1 |
| InChIKey |
MWIXENPCUPDSOS-QMMMGPOBSA-N |
| SMILES |
NNC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| CAS DataBase Reference |
7662-51-3(CAS DataBase Reference) |
| EPA Substance Registry System |
L-Tyrosine, hydrazide (7662-51-3) |