| Melting point |
151-155 °C |
| Boiling point |
557.9±33.0 °C(Predicted) |
| Density |
1.230±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka |
3.91±0.20(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
[α]20/D 21±1°, c = 2% in DMF |
| BRN |
5883879 |
| Major Application |
peptide synthesis |
| InChI |
1S/C20H21NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h3-6,8-11,17-18H,2,7,12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1 |
| InChIKey |
JBIJSEUVWWLFGV-SFHVURJKSA-N |
| SMILES |
N([C@@H](CCC)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| CAS DataBase Reference |
135112-28-6(CAS DataBase Reference) |
