| Melting point |
261-263 °C (lit.) |
| Boiling point |
417.49°C (rough estimate) |
| Density |
1.27 g/cm3 at 32 °C |
| bulk density |
350-450kg/m3 |
| vapor pressure |
<0.00001 Pa ( 50 °C) |
| refractive index |
1.5400 (estimate) |
| Flash point |
24 °C |
| storage temp. |
no restrictions. |
| solubility |
Soluble in alcohol. Slightly soluble in ether. Slightly soluble in dimethyl sulfoxide and insoluble in benzene or hexane. |
| form |
Solid |
| pka |
9.4(at 25℃) |
| Colour Index |
764 |
| color |
White to yellow-white |
| PH |
7.8~10.0 |
| Odor |
Odorless |
| PH Range |
8.0(colorless)-10(Red) |
| Water Solubility |
<0.1 g/100 mL |
| λmax |
552nm, 553nm, 374nm, 205nm, 229nm, 276nm |
| Merck |
14,7243 |
| BRN |
284423 |
| Henry's Law Constant |
1.1×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with strong oxidizing agents, alkalies. |
| Major Application |
Display device, sensors, semiconductors, fuel cells, photoreceptors, electronic packaging, authentication system for secure documents, inks, correction fluid, paints, detection of defects in films, floor coatings, textiles, corrosion testing, explosive, concrete, toys, detecting lipase activity of crop seeds, soaps, method for prevention of drugmisuse, cosmetics, diapers, detecting viable cells, carbohydrates, antimalarial, treating amyloid-associated diseases |
| Cosmetics Ingredients Functions |
NOT REPORTED |
| InChI |
1S/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12,21-22H |
| InChIKey |
KJFMBFZCATUALV-UHFFFAOYSA-N |
| SMILES |
Oc1ccc(cc1)C2(OC(=O)c3ccccc23)c4ccc(O)cc4 |
| LogP |
2.410 |
| CAS DataBase Reference |
77-09-8(CAS DataBase Reference) |
| IARC |
2B (Vol. 76) 2000 |
| NIST Chemistry Reference |
Phenolphthalein(77-09-8) |
| EPA Substance Registry System |
3,3-Bis(4-hydroxyphenyl)phthalide (77-09-8) |