| Melting point |
90-94 °C(lit.) |
| Boiling point |
389 °C / 719mmHg |
| Density |
1.3319 (estimate) |
| storage temp. |
-20°C Freezer, Under inert atmosphere |
| solubility |
acetone: soluble74.4 g/100ml at 20°C(lit.) |
| form |
Solid |
| color |
White to Off-White |
| Merck |
14,8988 |
| Henry's Law Constant |
5.2×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
1S/C12H9ClO2S/c13-10-6-8-12(9-7-10)16(14,15)11-4-2-1-3-5-11/h1-9H |
| InChIKey |
OFCFYWOKHPOXKF-UHFFFAOYSA-N |
| SMILES |
Clc1ccc(cc1)S(=O)(=O)c2ccccc2 |
| CAS DataBase Reference |
80-00-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzene, 1-chloro-4-(phenylsulfonyl)-(80-00-2) |
| EPA Substance Registry System |
p-Chlorophenyl phenyl sulfone (80-00-2) |