| Melting point |
-28°C (estimate) |
| Boiling point |
88-90 °C12 mm Hg(lit.) |
| Density |
0.846 g/mL at 25 °C(lit.) |
| vapor density |
>1 (vs air) |
| refractive index |
n20/D 1.453(lit.) |
| FEMA |
3213 | 2-NONENAL |
| Flash point |
184 °F |
| storage temp. |
Refrigerator (+4°C) |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Liquid |
| color |
Clear colorless to pale yellow |
| Odor |
at 1.00 % in dipropylene glycol. fatty green cucumber aldehydic citrus |
| Odor Type |
fatty |
| biological source |
synthetic |
| Water Solubility |
Soluble in Alcohol , and oils. Insoluble in water. |
| Sensitive |
Air Sensitive |
| Merck |
14,6676 |
| JECFA Number |
1362 |
| Henry's Law Constant |
5.8×10-2 mol/(m3Pa) at 25℃, Roberts and Pollien (1997) |
| Major Application |
cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C9H16O/c1-2-3-4-5-6-7-8-9-10/h7-9H,2-6H2,1H3/b8-7+ |
| InChIKey |
BSAIUMLZVGUGKX-BQYQJAHWSA-N |
| SMILES |
[H]C(=O)C(\[H])=C(/[H])CCCCCC |
| LogP |
3.17 |
| CAS DataBase Reference |
18829-56-6(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Nonenal, (2E)- (18829-56-6) |