| Melting point |
−4 °C(lit.) |
| Boiling point |
58-60 °C(lit.) |
| Density |
1.669 g/mL at 25 °C(lit.) |
| vapor pressure |
26.5kPa at 25℃ |
| refractive index |
n20/D 1.252(lit.) |
| Flash point |
56-60°C |
| form |
Liquid |
| Specific Gravity |
1.699 |
| color |
Clear colorless |
| Water Solubility |
Immiscible with water. |
| Thermal Conductivity |
0.064 W/(m·K) at 25 ℃ |
| Merck |
14,7157 |
| BRN |
1802113 |
| Henry's Law Constant |
9.3×10-9 mol/(m3Pa) at 25℃, Brockbank (2013) |
| Dielectric constant |
1.5700000000000001 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
SOLVENT |
| InChI |
1S/C6F14/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey |
ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| SMILES |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| LogP |
4.5 at 20℃ and pH7 |
| Surface tension |
11.91mN/m at 20°C |
| CAS DataBase Reference |
355-42-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Perfluorohexane (355-42-0) |
